C16H17NO2 — CID 102428321
(1E,3E,5E,7E,9E,11E,13E)-1-nitrohexadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 102428321) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (1E,3E,5E,7E,9E,11E,13E)-1-nitrohexadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | (1E,3E,5E,7E,9E,11E,13E)-1-nitrohexadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 102428321 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (1E,3E,5E,7E,9E,11E,13E)-1-nitrohexadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[N+](=O)[O-] |
| InChI | InChI=1S/C16H17NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-16H,1H2/b4-3+,6-5+,8-7+,10-9+,12-11+,14-13+,16-15+ |
| InChIKey | INRNCOUYILRBDT-BFJBGEJMSA-N |
| XLogP | 4.30 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|