C8H10N2O2 — CID 102095287
(1E,3E,5E,7E)-8-nitroocta-1,3,5,7-tetraen-1-amine (PubChem CID 102095287) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is (1E,3E,5E,7E)-8-nitroocta-1,3,5,7-tetraen-1-amine.
| Compound Name | (1E,3E,5E,7E)-8-nitroocta-1,3,5,7-tetraen-1-amine |
|---|---|
| PubChem CID | 102095287 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | (1E,3E,5E,7E)-8-nitroocta-1,3,5,7-tetraen-1-amine |
| SMILES | N/C=C/C=C/C=C/C=C/[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N2O2/c9-7-5-3-1-2-4-6-8-10(11)12/h1-8H,9H2/b3-1+,4-2+,7-5+,8-6+ |
| InChIKey | VMLFJPBFXBRFKF-QEQQUMNJSA-N |
| XLogP | 1.36 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|