C14H22O6 — CID 102428602
[(2R,3S,4R,5S,6R)-3,4,5-trimethoxy-6-prop-1-ynyloxan-2-yl]methyl acetate (PubChem CID 102428602) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-3,4,5-trimethoxy-6-prop-1-ynyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6R)-3,4,5-trimethoxy-6-prop-1-ynyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102428602 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-3,4,5-trimethoxy-6-prop-1-ynyloxan-2-yl]methyl acetate |
| SMILES | CC#C[C@H]1O[C@H](COC(C)=O)[C@H](OC)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C14H22O6/c1-6-7-10-12(16-3)14(18-5)13(17-4)11(20-10)8-19-9(2)15/h10-14H,8H2,1-5H3/t10-,11-,12+,13+,14-/m1/s1 |
| InChIKey | DSIUXBATNNQAEK-PEBLQZBPSA-N |
| XLogP | 0.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|