C13H15ClN2 — CID 10243146
3-chloro-6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline (PubChem CID 10243146) has the molecular formula C13H15ClN2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 3-chloro-6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline.
| Compound Name | 3-chloro-6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline |
|---|---|
| PubChem CID | 10243146 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-chloro-6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline |
| SMILES | Clc1ccc2c(c1)N=C1CCCCCN1C2 |
| InChI | InChI=1S/C13H15ClN2/c14-11-6-5-10-9-16-7-3-1-2-4-13(16)15-12(10)8-11/h5-6,8H,1-4,7,9H2 |
| InChIKey | JHFVYQMIQHRAQS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |