C31H31N3O3 — CID 102432913
N-[2-(tert-butylamino)-1-(1H-indol-2-yl)-2-oxoethyl]-N-[(4-methoxyphenyl)methyl]-3-phenylprop-2-ynamide (PubChem CID 102432913) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-1-(1H-indol-2-yl)-2-oxoethyl]-N-[(4-methoxyphenyl)methyl]-3-phenylprop-2-ynamide.
| Compound Name | N-[2-(tert-butylamino)-1-(1H-indol-2-yl)-2-oxoethyl]-N-[(4-methoxyphenyl)methyl]-3-phenylprop-2-ynamide |
|---|---|
| PubChem CID | 102432913 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | N-[2-(tert-butylamino)-1-(1H-indol-2-yl)-2-oxoethyl]-N-[(4-methoxyphenyl)methyl]-3-phenylprop-2-ynamide |
| SMILES | COc1ccc(CN(C(=O)C#Cc2ccccc2)C(C(=O)NC(C)(C)C)c2cc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C31H31N3O3/c1-31(2,3)33-30(36)29(27-20-24-12-8-9-13-26(24)32-27)34(21-23-14-17-25(37-4)18-15-23)28(35)19-16-22-10-6-5-7-11-22/h5-15,17-18,20,29,32H,21H2,1-4H3,(H,33,36) |
| InChIKey | DXUZWPCJDHTXTM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|