C26H36N2 — CID 102434399
4-[2-[4-[di(propan-2-yl)amino]phenyl]ethynyl]-N,N-di(propan-2-yl)aniline (PubChem CID 102434399) has the molecular formula C26H36N2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 4-[2-[4-[di(propan-2-yl)amino]phenyl]ethynyl]-N,N-di(propan-2-yl)aniline.
| Compound Name | 4-[2-[4-[di(propan-2-yl)amino]phenyl]ethynyl]-N,N-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 102434399 |
| Molecular Formula | C26H36N2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | 4-[2-[4-[di(propan-2-yl)amino]phenyl]ethynyl]-N,N-di(propan-2-yl)aniline |
| SMILES | CC(C)N(c1ccc(C#Cc2ccc(N(C(C)C)C(C)C)cc2)cc1)C(C)C |
| InChI | InChI=1S/C26H36N2/c1-19(2)27(20(3)4)25-15-11-23(12-16-25)9-10-24-13-17-26(18-14-24)28(21(5)6)22(7)8/h11-22H,1-8H3 |
| InChIKey | UUQYKYVJIDCFJB-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|