C18H30O3Si — CID 102434980
[(E)-9-[tert-butyl(dimethyl)silyl]oxy-4-methylidenenon-2-en-5-ynyl] acetate (PubChem CID 102434980) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is [(E)-9-[tert-butyl(dimethyl)silyl]oxy-4-methylidenenon-2-en-5-ynyl] acetate.
| Compound Name | [(E)-9-[tert-butyl(dimethyl)silyl]oxy-4-methylidenenon-2-en-5-ynyl] acetate |
|---|---|
| PubChem CID | 102434980 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | [(E)-9-[tert-butyl(dimethyl)silyl]oxy-4-methylidenenon-2-en-5-ynyl] acetate |
| SMILES | C=C(C#CCCCO[Si](C)(C)C(C)(C)C)/C=C/COC(C)=O |
| InChI | InChI=1S/C18H30O3Si/c1-16(13-11-14-20-17(2)19)12-9-8-10-15-21-22(6,7)18(3,4)5/h11,13H,1,8,10,14-15H2,2-7H3/b13-11+ |
| InChIKey | WMUYOYFHDZLASP-ACCUITESSA-N |
| XLogP | 4.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|