C14H20O4 — CID 102435932
[(1R)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate (PubChem CID 102435932) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is [(1R)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate.
| Compound Name | [(1R)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 102435932 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [(1R)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] prop-2-enoate |
| SMILES | C=CC[C@@H](OC(=O)C=C)[C@H]1OC(C)(C)O[C@@H]1C=C |
| InChI | InChI=1S/C14H20O4/c1-6-9-11(16-12(15)8-3)13-10(7-2)17-14(4,5)18-13/h6-8,10-11,13H,1-3,9H2,4-5H3/t10-,11-,13+/m1/s1 |
| InChIKey | CQFOCNVFMFDTGX-WZRBSPASSA-N |
| XLogP | 2.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|