C22H33NO5 — CID 102436100
(2S)-2-[[(4E,8R,10E,12E,14E)-4,8-dimethyl-3-oxohexadeca-4,10,12,14-tetraenoyl]-methylamino]-3-hydroxypropanoic acid (PubChem CID 102436100) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is (2S)-2-[[(4E,8R,10E,12E,14E)-4,8-dimethyl-3-oxohexadeca-4,10,12,14-tetraenoyl]-methylamino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(4E,8R,10E,12E,14E)-4,8-dimethyl-3-oxohexadeca-4,10,12,14-tetraenoyl]-methylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 102436100 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | (2S)-2-[[(4E,8R,10E,12E,14E)-4,8-dimethyl-3-oxohexadeca-4,10,12,14-tetraenoyl]-methylamino]-3-hydroxypropanoic acid |
| SMILES | C/C=C/C=C/C=C/C[C@H](C)CC/C=C(\C)C(=O)CC(=O)N(C)[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C22H33NO5/c1-5-6-7-8-9-10-12-17(2)13-11-14-18(3)20(25)15-21(26)23(4)19(16-24)22(27)28/h5-10,14,17,19,24H,11-13,15-16H2,1-4H3,(H,27,28)/b6-5+,8-7+,10-9+,18-14+/t17-,19-/m0/s1 |
| InChIKey | XHRGNBGNHANDJM-YBYQWMHRSA-N |
| XLogP | 3.29 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|