C31H30NO2P — CID 102436121
(E)-N-benzyl-N-(2-diphenylphosphoryl-4,6-dimethylphenyl)but-2-enamide (PubChem CID 102436121) has the molecular formula C31H30NO2P and a molecular weight of 479.56 g/mol. Its IUPAC name is (E)-N-benzyl-N-(2-diphenylphosphoryl-4,6-dimethylphenyl)but-2-enamide.
| Compound Name | (E)-N-benzyl-N-(2-diphenylphosphoryl-4,6-dimethylphenyl)but-2-enamide |
|---|---|
| PubChem CID | 102436121 |
| Molecular Formula | C31H30NO2P |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | (E)-N-benzyl-N-(2-diphenylphosphoryl-4,6-dimethylphenyl)but-2-enamide |
| SMILES | C/C=C/C(=O)N(Cc1ccccc1)c1c(C)cc(C)cc1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30NO2P/c1-4-14-30(33)32(23-26-15-8-5-9-16-26)31-25(3)21-24(2)22-29(31)35(34,27-17-10-6-11-18-27)28-19-12-7-13-20-28/h4-22H,23H2,1-3H3/b14-4+ |
| InChIKey | XSIQTPZFWDFLNS-LNKIKWGQSA-N |
| XLogP | 6.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|