C25H22N2O — CID 139259162
(E)-N-benzyl-N-(2-cyano-4,6-dimethylphenyl)-3-phenylprop-2-enamide (PubChem CID 139259162) has the molecular formula C25H22N2O and a molecular weight of 366.46 g/mol. Its IUPAC name is (E)-N-benzyl-N-(2-cyano-4,6-dimethylphenyl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-benzyl-N-(2-cyano-4,6-dimethylphenyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 139259162 |
| Molecular Formula | C25H22N2O |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (E)-N-benzyl-N-(2-cyano-4,6-dimethylphenyl)-3-phenylprop-2-enamide |
| SMILES | Cc1cc(C)c(N(Cc2ccccc2)C(=O)/C=C/c2ccccc2)c(C#N)c1 |
| InChI | InChI=1S/C25H22N2O/c1-19-15-20(2)25(23(16-19)17-26)27(18-22-11-7-4-8-12-22)24(28)14-13-21-9-5-3-6-10-21/h3-16H,18H2,1-2H3/b14-13+ |
| InChIKey | NQMZEAMVOZLVKE-BUHFOSPRSA-N |
| XLogP | 5.42 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|