C24H22NO2P — CID 132608908
3-diphenylphosphoryl-1,5,7-trimethylquinolin-2-one (PubChem CID 132608908) has the molecular formula C24H22NO2P and a molecular weight of 387.42 g/mol. Its IUPAC name is 3-diphenylphosphoryl-1,5,7-trimethylquinolin-2-one.
| Compound Name | 3-diphenylphosphoryl-1,5,7-trimethylquinolin-2-one |
|---|---|
| PubChem CID | 132608908 |
| Molecular Formula | C24H22NO2P |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 3-diphenylphosphoryl-1,5,7-trimethylquinolin-2-one |
| SMILES | Cc1cc(C)c2cc(P(=O)(c3ccccc3)c3ccccc3)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C24H22NO2P/c1-17-14-18(2)21-16-23(24(26)25(3)22(21)15-17)28(27,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-16H,1-3H3 |
| InChIKey | ZSKHQWDSSURIHF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|