C12H14N2+2 — CID 102436446
8-phenyl-2,6-diazoniabicyclo[5.1.0]octa-2,5-diene (PubChem CID 102436446) has the molecular formula C12H14N2+2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 8-phenyl-2,6-diazoniabicyclo[5.1.0]octa-2,5-diene.
| Compound Name | 8-phenyl-2,6-diazoniabicyclo[5.1.0]octa-2,5-diene |
|---|---|
| PubChem CID | 102436446 |
| Molecular Formula | C12H14N2+2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 8-phenyl-2,6-diazoniabicyclo[5.1.0]octa-2,5-diene |
| SMILES | C1=[NH+]C2C([NH+]=CC1)C2c1ccccc1 |
| InChI | InChI=1S/C12H12N2/c1-2-5-9(6-3-1)10-11-12(10)14-8-4-7-13-11/h1-3,5-8,10-12H,4H2/p+2 |
| InChIKey | GSMHGUIBBQETDY-UHFFFAOYSA-P |
| XLogP | -1.77 |
| TPSA | 27.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |