C22H25NO4S — CID 102438784
5-[(1S)-1-(4-methylphenyl)sulfonyl-2-oxo-2-phenylethyl]-1-propan-2-ylpyrrolidin-2-one (PubChem CID 102438784) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is 5-[(1S)-1-(4-methylphenyl)sulfonyl-2-oxo-2-phenylethyl]-1-propan-2-ylpyrrolidin-2-one.
| Compound Name | 5-[(1S)-1-(4-methylphenyl)sulfonyl-2-oxo-2-phenylethyl]-1-propan-2-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 102438784 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 5-[(1S)-1-(4-methylphenyl)sulfonyl-2-oxo-2-phenylethyl]-1-propan-2-ylpyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)[C@H](C(=O)c2ccccc2)C2CCC(=O)N2C(C)C)cc1 |
| InChI | InChI=1S/C22H25NO4S/c1-15(2)23-19(13-14-20(23)24)22(21(25)17-7-5-4-6-8-17)28(26,27)18-11-9-16(3)10-12-18/h4-12,15,19,22H,13-14H2,1-3H3/t19?,22-/m0/s1 |
| InChIKey | IYDRWVHHNVSPEZ-BPARTEKVSA-N |
| XLogP | 3.42 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |