C10H12O5 — CID 102439918
methyl 3-(1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate (PubChem CID 102439918) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is methyl 3-(1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate.
| Compound Name | methyl 3-(1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate |
|---|---|
| PubChem CID | 102439918 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | methyl 3-(1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate |
| SMILES | COC(=O)CCC1(OO)C=CC(=O)C=C1 |
| InChI | InChI=1S/C10H12O5/c1-14-9(12)4-7-10(15-13)5-2-8(11)3-6-10/h2-3,5-6,13H,4,7H2,1H3 |
| InChIKey | YIPGQABOPJQSBK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|