C14H24O4 — CID 10244142
2-[(3S,4Z,6S)-6-butyl-6-ethyl-4-ethylidenedioxan-3-yl]acetic acid (PubChem CID 10244142) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is 2-[(3S,4Z,6S)-6-butyl-6-ethyl-4-ethylidenedioxan-3-yl]acetic acid.
| Compound Name | 2-[(3S,4Z,6S)-6-butyl-6-ethyl-4-ethylidenedioxan-3-yl]acetic acid |
|---|---|
| PubChem CID | 10244142 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-[(3S,4Z,6S)-6-butyl-6-ethyl-4-ethylidenedioxan-3-yl]acetic acid |
| SMILES | C/C=C1/C[C@](CC)(CCCC)OO[C@H]1CC(=O)O |
| InChI | InChI=1S/C14H24O4/c1-4-7-8-14(6-3)10-11(5-2)12(17-18-14)9-13(15)16/h5,12H,4,6-10H2,1-3H3,(H,15,16)/b11-5-/t12-,14-/m0/s1 |
| InChIKey | BJPWYJPXKWNMRI-DRHNYNEPSA-N |
| XLogP | 3.47 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|