C11H19NO9 — CID 102445847
4-O-[(2S,3R,4S,5R)-1-amino-2,3,4,5-tetrahydroxy-6-oxohexyl] 1-O-methyl butanedioate (PubChem CID 102445847) has the molecular formula C11H19NO9 and a molecular weight of 309.27 g/mol. Its IUPAC name is 4-O-[(2S,3R,4S,5R)-1-amino-2,3,4,5-tetrahydroxy-6-oxohexyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[(2S,3R,4S,5R)-1-amino-2,3,4,5-tetrahydroxy-6-oxohexyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 102445847 |
| Molecular Formula | C11H19NO9 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-O-[(2S,3R,4S,5R)-1-amino-2,3,4,5-tetrahydroxy-6-oxohexyl] 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)OC(N)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C11H19NO9/c1-20-6(15)2-3-7(16)21-11(12)10(19)9(18)8(17)5(14)4-13/h4-5,8-11,14,17-19H,2-3,12H2,1H3/t5-,8+,9+,10-,11?/m0/s1 |
| InChIKey | UBTUOPHRKBOZBI-YYIAWMQLSA-N |
| XLogP | -3.59 |
| TPSA | 176.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|