C22H22N2O5 — CID 102447636
(4Z)-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(4-nitrophenyl)methylidene]-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 102447636) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is (4Z)-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(4-nitrophenyl)methylidene]-3-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | (4Z)-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(4-nitrophenyl)methylidene]-3-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 102447636 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (4Z)-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(4-nitrophenyl)methylidene]-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | COc1ccc(CCN2C(=O)C3CC3/C2=C/c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C22H22N2O5/c1-28-20-8-5-15(12-21(20)29-2)9-10-23-19(17-13-18(17)22(23)25)11-14-3-6-16(7-4-14)24(26)27/h3-8,11-12,17-18H,9-10,13H2,1-2H3/b19-11- |
| InChIKey | YWORZWUYZHYZKQ-ODLFYWEKSA-N |
| XLogP | 3.67 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|