C11H17NO2 — CID 102448109
(6S,7E)-7-hexylidene-3-oxa-1-azabicyclo[4.1.0]heptan-2-one (PubChem CID 102448109) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (6S,7E)-7-hexylidene-3-oxa-1-azabicyclo[4.1.0]heptan-2-one.
| Compound Name | (6S,7E)-7-hexylidene-3-oxa-1-azabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 102448109 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (6S,7E)-7-hexylidene-3-oxa-1-azabicyclo[4.1.0]heptan-2-one |
| SMILES | CCCCC/C=C1\[C@@H]2CCOC(=O)N12 |
| InChI | InChI=1S/C11H17NO2/c1-2-3-4-5-6-9-10-7-8-14-11(13)12(9)10/h6,10H,2-5,7-8H2,1H3/b9-6+/t10-,12?/m0/s1 |
| InChIKey | FDZACAUUUVBWOR-CNVHZQPBSA-N |
| XLogP | 2.68 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|