About [(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate
[(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate (PubChem CID 118943913) has the molecular formula C13H21NO4
and a molecular weight of 255.31 g/mol. Its IUPAC name is [(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate.
Molecular Properties
| Compound Name | [(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate |
| PubChem CID | 118943913 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | [(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate |
| SMILES | CCCCC/C=C1/NC(=O)OCC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H21NO4/c1-3-4-5-6-7-11-12(18-10(2)15)8-9-17-13(16)14-11/h7,12H,3-6,8-9H2,1-2H3,(H,14,16)/b11-7+/t12-/m0/s1 |
| InChIKey | YTMZAAGPOVVPCG-VNKGSWCUSA-N |
| XLogP | 2.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate?
The IUPAC name of [(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate (CID 118943913) is [(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate.
What is the SMILES notation for [(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate?
The canonical SMILES for [(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate is CCCCC/C=C1/NC(=O)OCC[C@@H]1OC(C)=O.
What is the InChIKey of [(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate?
The InChIKey is YTMZAAGPOVVPCG-VNKGSWCUSA-N. The full InChI is InChI=1S/C13H21NO4/c1-3-4-5-6-7-11-12(18-10(2)15)8-9-17-13(16)14-11/h7,12H,3-6,8-9H2,1-2H3,(H,14,16)/b11-7+/t12-/m0/s1.
What are the key properties of [(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate?
[(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate has a molecular weight of 255.31 g/mol, XLogP of 2.51, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4E,5S)-4-hexylidene-2-oxo-1,3-oxazepan-5-yl] acetate is sourced from PubChem (CID 118943913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).