C12H21N3O4 — CID 131991408
[(3R,4R)-1-amino-2-butyl-8-oxo-7-oxa-1,9-diazaspiro[2.6]nonan-4-yl] acetate (PubChem CID 131991408) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is [(3R,4R)-1-amino-2-butyl-8-oxo-7-oxa-1,9-diazaspiro[2.6]nonan-4-yl] acetate.
| Compound Name | [(3R,4R)-1-amino-2-butyl-8-oxo-7-oxa-1,9-diazaspiro[2.6]nonan-4-yl] acetate |
|---|---|
| PubChem CID | 131991408 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | [(3R,4R)-1-amino-2-butyl-8-oxo-7-oxa-1,9-diazaspiro[2.6]nonan-4-yl] acetate |
| SMILES | CCCCC1N(N)[C@]12NC(=O)OCC[C@H]2OC(C)=O |
| InChI | InChI=1S/C12H21N3O4/c1-3-4-5-9-12(15(9)13)10(19-8(2)16)6-7-18-11(17)14-12/h9-10H,3-7,13H2,1-2H3,(H,14,17)/t9?,10-,12-,15?/m1/s1 |
| InChIKey | ZCKFVCOANDNTDB-QYCSZPHCSA-N |
| XLogP | 0.49 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|