C14H22BrNO6S — CID 123868795
[(4S,5R)-4-[(1S)-1-bromohexyl]-2,2-dioxo-4-(2-oxoethenyl)oxathiazepan-5-yl] acetate (PubChem CID 123868795) has the molecular formula C14H22BrNO6S and a molecular weight of 412.30 g/mol. Its IUPAC name is [(4S,5R)-4-[(1S)-1-bromohexyl]-2,2-dioxo-4-(2-oxoethenyl)oxathiazepan-5-yl] acetate.
| Compound Name | [(4S,5R)-4-[(1S)-1-bromohexyl]-2,2-dioxo-4-(2-oxoethenyl)oxathiazepan-5-yl] acetate |
|---|---|
| PubChem CID | 123868795 |
| Molecular Formula | C14H22BrNO6S |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | [(4S,5R)-4-[(1S)-1-bromohexyl]-2,2-dioxo-4-(2-oxoethenyl)oxathiazepan-5-yl] acetate |
| SMILES | CCCCC[C@H](Br)[C@@]1(C=C=O)NS(=O)(=O)OCC[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H22BrNO6S/c1-3-4-5-6-12(15)14(8-9-17)13(22-11(2)18)7-10-21-23(19,20)16-14/h8,12-13,16H,3-7,10H2,1-2H3/t12-,13+,14+/m0/s1 |
| InChIKey | RFYWINZDKDQRHR-BFHYXJOUSA-N |
| XLogP | 1.64 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|