C13H20BrNO4 — CID 118943912
[(5S)-4-[(1S)-1-bromohexyl]-2-oxo-6,7-dihydro-5H-1,3-oxazepin-5-yl] acetate (PubChem CID 118943912) has the molecular formula C13H20BrNO4 and a molecular weight of 334.21 g/mol. Its IUPAC name is [(5S)-4-[(1S)-1-bromohexyl]-2-oxo-6,7-dihydro-5H-1,3-oxazepin-5-yl] acetate.
| Compound Name | [(5S)-4-[(1S)-1-bromohexyl]-2-oxo-6,7-dihydro-5H-1,3-oxazepin-5-yl] acetate |
|---|---|
| PubChem CID | 118943912 |
| Molecular Formula | C13H20BrNO4 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | [(5S)-4-[(1S)-1-bromohexyl]-2-oxo-6,7-dihydro-5H-1,3-oxazepin-5-yl] acetate |
| SMILES | CCCCC[C@H](Br)C1=NC(=O)OCC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H20BrNO4/c1-3-4-5-6-10(14)12-11(19-9(2)16)7-8-18-13(17)15-12/h10-11H,3-8H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | IEBAKGFOGQEQMP-QWRGUYRKSA-N |
| XLogP | 3.24 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|