C44H81BrO4 — CID 143992098
bromomethane;ethane;3-[(6Z,9Z,28Z,31Z)-19-hydroxyheptatriaconta-6,9,28,31-tetraen-19-yl]oxyoxolan-2-one (PubChem CID 143992098) has the molecular formula C44H81BrO4 and a molecular weight of 754.03 g/mol. Its IUPAC name is bromomethane;ethane;3-[(6Z,9Z,28Z,31Z)-19-hydroxyheptatriaconta-6,9,28,31-tetraen-19-yl]oxyoxolan-2-one.
| Compound Name | bromomethane;ethane;3-[(6Z,9Z,28Z,31Z)-19-hydroxyheptatriaconta-6,9,28,31-tetraen-19-yl]oxyoxolan-2-one |
|---|---|
| PubChem CID | 143992098 |
| Molecular Formula | C44H81BrO4 |
| Molecular Weight | 754.03 g/mol |
| Exact Mass | 752.53 |
| IUPAC Name | bromomethane;ethane;3-[(6Z,9Z,28Z,31Z)-19-hydroxyheptatriaconta-6,9,28,31-tetraen-19-yl]oxyoxolan-2-one |
| SMILES | CBr.CC.CCCCC/C=C\C/C=C\CCCCCCCCC(O)(CCCCCCCC/C=C\C/C=C\CCCCC)OC1CCOC1=O |
| InChI | InChI=1S/C41H72O4.C2H6.CH3Br/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-41(43,45-39-35-38-44-40(39)42)37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;2*1-2/h11-14,17-20,39,43H,3-10,15-16,21-38H2,1-2H3;1-2H3;1H3/b13-11-,14-12-,19-17-,20-18-;; |
| InChIKey | JGNIBVFPZMFWPV-ODACLVRCSA-N |
| XLogP | 14.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.03 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|