C45H83NO2 — CID 134314266
(6Z,9Z,28Z,31Z)-19-[4-(dimethylamino)cyclohexyl]oxyheptatriaconta-6,9,28,31-tetraen-19-ol (PubChem CID 134314266) has the molecular formula C45H83NO2 and a molecular weight of 670.16 g/mol. Its IUPAC name is (6Z,9Z,28Z,31Z)-19-[4-(dimethylamino)cyclohexyl]oxyheptatriaconta-6,9,28,31-tetraen-19-ol.
| Compound Name | (6Z,9Z,28Z,31Z)-19-[4-(dimethylamino)cyclohexyl]oxyheptatriaconta-6,9,28,31-tetraen-19-ol |
|---|---|
| PubChem CID | 134314266 |
| Molecular Formula | C45H83NO2 |
| Molecular Weight | 670.16 g/mol |
| Exact Mass | 669.64 |
| IUPAC Name | (6Z,9Z,28Z,31Z)-19-[4-(dimethylamino)cyclohexyl]oxyheptatriaconta-6,9,28,31-tetraen-19-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(O)(CCCCCCCC/C=C\C/C=C\CCCCC)OC1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C45H83NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41-45(47,48-44-39-37-43(38-40-44)46(3)4)42-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,43-44,47H,5-12,17-18,23-42H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | GKFMHTFUSDZNKB-KWXKLSQISA-N |
| XLogP | 13.97 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.16 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|