C10H19NO4S — CID 123145858
4-hexylidene-2,2-dioxooxathiazepan-5-ol (PubChem CID 123145858) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is 4-hexylidene-2,2-dioxooxathiazepan-5-ol.
| Compound Name | 4-hexylidene-2,2-dioxooxathiazepan-5-ol |
|---|---|
| PubChem CID | 123145858 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4-hexylidene-2,2-dioxooxathiazepan-5-ol |
| SMILES | CCCCCC=C1NS(=O)(=O)OCCC1O |
| InChI | InChI=1S/C10H19NO4S/c1-2-3-4-5-6-9-10(12)7-8-15-16(13,14)11-9/h6,10-12H,2-5,7-8H2,1H3 |
| InChIKey | MLNFJSVJHJJDFU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|