C23H25BrO2 — CID 102449373
(E)-3-(4-bromophenyl)-4-methyl-7-oxo-7-(2,4,6-trimethylphenyl)hept-5-enal (PubChem CID 102449373) has the molecular formula C23H25BrO2 and a molecular weight of 413.36 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-4-methyl-7-oxo-7-(2,4,6-trimethylphenyl)hept-5-enal.
| Compound Name | (E)-3-(4-bromophenyl)-4-methyl-7-oxo-7-(2,4,6-trimethylphenyl)hept-5-enal |
|---|---|
| PubChem CID | 102449373 |
| Molecular Formula | C23H25BrO2 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | (E)-3-(4-bromophenyl)-4-methyl-7-oxo-7-(2,4,6-trimethylphenyl)hept-5-enal |
| SMILES | Cc1cc(C)c(C(=O)/C=C/C(C)C(CC=O)c2ccc(Br)cc2)c(C)c1 |
| InChI | InChI=1S/C23H25BrO2/c1-15-13-17(3)23(18(4)14-15)22(26)10-5-16(2)21(11-12-25)19-6-8-20(24)9-7-19/h5-10,12-14,16,21H,11H2,1-4H3/b10-5+ |
| InChIKey | SCFGVUVWEYKYRM-BJMVGYQFSA-N |
| XLogP | 6.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|