C18H18O — CID 135060925
(E)-3-deuterio-3-phenyl-1-(2,4,6-trimethylphenyl)prop-2-en-1-one (PubChem CID 135060925) has the molecular formula C18H18O and a molecular weight of 251.35 g/mol. Its IUPAC name is (E)-3-deuterio-3-phenyl-1-(2,4,6-trimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-deuterio-3-phenyl-1-(2,4,6-trimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 135060925 |
| Molecular Formula | C18H18O |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (E)-3-deuterio-3-phenyl-1-(2,4,6-trimethylphenyl)prop-2-en-1-one |
| SMILES | [2H]/C(=C\C(=O)c1c(C)cc(C)cc1C)c1ccccc1 |
| InChI | InChI=1S/C18H18O/c1-13-11-14(2)18(15(3)12-13)17(19)10-9-16-7-5-4-6-8-16/h4-12H,1-3H3/b10-9+/i9D |
| InChIKey | FLJAEHNSTVEODG-VVEOIKBMSA-N |
| XLogP | 4.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|