About (3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde
(3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde (PubChem CID 102452286) has the molecular formula C23H19NO2
and a molecular weight of 341.41 g/mol. Its IUPAC name is (3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | (3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde |
| PubChem CID | 102452286 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde |
| SMILES | O=CC1=C(c2ccccc2)ON(Cc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H19NO2/c25-17-21-22(19-12-6-2-7-13-19)24(16-18-10-4-1-5-11-18)26-23(21)20-14-8-3-9-15-20/h1-15,17,22H,16H2/t22-/m0/s1 |
| InChIKey | VEYPNLAIESBDKM-QFIPXVFZSA-N |
| XLogP | 4.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde?
The IUPAC name of (3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde (CID 102452286) is (3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde.
What is the SMILES notation for (3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde?
The canonical SMILES for (3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde is O=CC1=C(c2ccccc2)ON(Cc2ccccc2)[C@H]1c1ccccc1.
What is the InChIKey of (3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde?
The InChIKey is VEYPNLAIESBDKM-QFIPXVFZSA-N. The full InChI is InChI=1S/C23H19NO2/c25-17-21-22(19-12-6-2-7-13-19)24(16-18-10-4-1-5-11-18)26-23(21)20-14-8-3-9-15-20/h1-15,17,22H,16H2/t22-/m0/s1.
What are the key properties of (3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde?
(3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde has a molecular weight of 341.41 g/mol, XLogP of 4.79, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2-benzyl-3,5-diphenyl-3H-1,2-oxazole-4-carbaldehyde is sourced from PubChem (CID 102452286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).