C44H32N2O2 — CID 102453863
(3Z)-3-[(2Z)-1,2-bis(4-methylphenyl)-2-(3-phenylimino-2-benzofuran-1-ylidene)ethylidene]-N-phenyl-2-benzofuran-1-imine (PubChem CID 102453863) has the molecular formula C44H32N2O2 and a molecular weight of 620.75 g/mol. Its IUPAC name is (3Z)-3-[(2Z)-1,2-bis(4-methylphenyl)-2-(3-phenylimino-2-benzofuran-1-ylidene)ethylidene]-N-phenyl-2-benzofuran-1-imine.
| Compound Name | (3Z)-3-[(2Z)-1,2-bis(4-methylphenyl)-2-(3-phenylimino-2-benzofuran-1-ylidene)ethylidene]-N-phenyl-2-benzofuran-1-imine |
|---|---|
| PubChem CID | 102453863 |
| Molecular Formula | C44H32N2O2 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | (3Z)-3-[(2Z)-1,2-bis(4-methylphenyl)-2-(3-phenylimino-2-benzofuran-1-ylidene)ethylidene]-N-phenyl-2-benzofuran-1-imine |
| SMILES | Cc1ccc(C(/C(=C2\O/C(=N/c3ccccc3)c3ccccc32)c2ccc(C)cc2)=C2/O/C(=N\c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C44H32N2O2/c1-29-21-25-31(26-22-29)39(41-35-17-9-11-19-37(35)43(47-41)45-33-13-5-3-6-14-33)40(32-27-23-30(2)24-28-32)42-36-18-10-12-20-38(36)44(48-42)46-34-15-7-4-8-16-34/h3-28H,1-2H3/b41-39-,42-40-,45-43-,46-44+ |
| InChIKey | HESIBBUHTUGECN-ZOBMCHBKSA-N |
| XLogP | 10.96 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|