C23H27ClN4O5 — CID 102454242
(2R)-N-[(1S)-1-(4-chlorophenyl)-2-hydrazinyl-2-oxoethyl]-1-[4-(dimethoxymethyl)benzoyl]pyrrolidine-2-carboxamide (PubChem CID 102454242) has the molecular formula C23H27ClN4O5 and a molecular weight of 474.95 g/mol. Its IUPAC name is (2R)-N-[(1S)-1-(4-chlorophenyl)-2-hydrazinyl-2-oxoethyl]-1-[4-(dimethoxymethyl)benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(1S)-1-(4-chlorophenyl)-2-hydrazinyl-2-oxoethyl]-1-[4-(dimethoxymethyl)benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 102454242 |
| Molecular Formula | C23H27ClN4O5 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (2R)-N-[(1S)-1-(4-chlorophenyl)-2-hydrazinyl-2-oxoethyl]-1-[4-(dimethoxymethyl)benzoyl]pyrrolidine-2-carboxamide |
| SMILES | COC(OC)c1ccc(C(=O)N2CCC[C@@H]2C(=O)N[C@H](C(=O)NN)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H27ClN4O5/c1-32-23(33-2)16-7-5-15(6-8-16)22(31)28-13-3-4-18(28)20(29)26-19(21(30)27-25)14-9-11-17(24)12-10-14/h5-12,18-19,23H,3-4,13,25H2,1-2H3,(H,26,29)(H,27,30)/t18-,19+/m1/s1 |
| InChIKey | VXFZXPAWWDITHM-MOPGFXCFSA-N |
| XLogP | 2.08 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|