C18H26N4O5 — CID 102290347
(2R)-1-[4-(dimethoxymethyl)benzoyl]-N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 102290347) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is (2R)-1-[4-(dimethoxymethyl)benzoyl]-N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[4-(dimethoxymethyl)benzoyl]-N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 102290347 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (2R)-1-[4-(dimethoxymethyl)benzoyl]-N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | COC(OC)c1ccc(C(=O)N2CCC[C@@H]2C(=O)N[C@@H](C)C(=O)NN)cc1 |
| InChI | InChI=1S/C18H26N4O5/c1-11(15(23)21-19)20-16(24)14-5-4-10-22(14)17(25)12-6-8-13(9-7-12)18(26-2)27-3/h6-9,11,14,18H,4-5,10,19H2,1-3H3,(H,20,24)(H,21,23)/t11-,14+/m0/s1 |
| InChIKey | SKXXQGFFOALLBJ-SMDDNHRTSA-N |
| XLogP | 0.08 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|