C23H28N4O5 — CID 100951099
(2S)-1-[4-(dimethoxymethyl)benzoyl]-N-[(1S)-2-hydrazinyl-2-oxo-1-phenylethyl]pyrrolidine-2-carboxamide (PubChem CID 100951099) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is (2S)-1-[4-(dimethoxymethyl)benzoyl]-N-[(1S)-2-hydrazinyl-2-oxo-1-phenylethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[4-(dimethoxymethyl)benzoyl]-N-[(1S)-2-hydrazinyl-2-oxo-1-phenylethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 100951099 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (2S)-1-[4-(dimethoxymethyl)benzoyl]-N-[(1S)-2-hydrazinyl-2-oxo-1-phenylethyl]pyrrolidine-2-carboxamide |
| SMILES | COC(OC)c1ccc(C(=O)N2CCC[C@H]2C(=O)N[C@H](C(=O)NN)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H28N4O5/c1-31-23(32-2)17-12-10-16(11-13-17)22(30)27-14-6-9-18(27)20(28)25-19(21(29)26-24)15-7-4-3-5-8-15/h3-5,7-8,10-13,18-19,23H,6,9,14,24H2,1-2H3,(H,25,28)(H,26,29)/t18-,19-/m0/s1 |
| InChIKey | DGPLMEFWIHXJAE-OALUTQOASA-N |
| XLogP | 1.43 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|