C19H28N4O5 — CID 102392381
(2R)-1-[4-(dimethoxymethyl)benzoyl]-N-(1-hydrazinyl-2-methyl-1-oxopropan-2-yl)pyrrolidine-2-carboxamide (PubChem CID 102392381) has the molecular formula C19H28N4O5 and a molecular weight of 392.46 g/mol. Its IUPAC name is (2R)-1-[4-(dimethoxymethyl)benzoyl]-N-(1-hydrazinyl-2-methyl-1-oxopropan-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[4-(dimethoxymethyl)benzoyl]-N-(1-hydrazinyl-2-methyl-1-oxopropan-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 102392381 |
| Molecular Formula | C19H28N4O5 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (2R)-1-[4-(dimethoxymethyl)benzoyl]-N-(1-hydrazinyl-2-methyl-1-oxopropan-2-yl)pyrrolidine-2-carboxamide |
| SMILES | COC(OC)c1ccc(C(=O)N2CCC[C@@H]2C(=O)NC(C)(C)C(=O)NN)cc1 |
| InChI | InChI=1S/C19H28N4O5/c1-19(2,18(26)22-20)21-15(24)14-6-5-11-23(14)16(25)12-7-9-13(10-8-12)17(27-3)28-4/h7-10,14,17H,5-6,11,20H2,1-4H3,(H,21,24)(H,22,26)/t14-/m1/s1 |
| InChIKey | SPXGTWGBWRPNPO-CQSZACIVSA-N |
| XLogP | 0.47 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|