C15H24Se — CID 102454975
(1S,2S,4R)-2-cyclopenta-2,4-dien-1-ylselanyl-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 102454975) has the molecular formula C15H24Se and a molecular weight of 283.32 g/mol. Its IUPAC name is (1S,2S,4R)-2-cyclopenta-2,4-dien-1-ylselanyl-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2S,4R)-2-cyclopenta-2,4-dien-1-ylselanyl-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 102454975 |
| Molecular Formula | C15H24Se |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (1S,2S,4R)-2-cyclopenta-2,4-dien-1-ylselanyl-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1[Se]C1C=CC=C1 |
| InChI | InChI=1S/C15H24Se/c1-11(2)14-9-8-12(3)10-15(14)16-13-6-4-5-7-13/h4-7,11-15H,8-10H2,1-3H3/t12-,14+,15+/m1/s1 |
| InChIKey | IGOSEFAVLLIKAT-SNPRPXQTSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|