C23H28N2O2S — CID 102455391
4-methyl-N-[(2R)-2-(2-methylquinolin-6-yl)hexyl]benzenesulfonamide (PubChem CID 102455391) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is 4-methyl-N-[(2R)-2-(2-methylquinolin-6-yl)hexyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2R)-2-(2-methylquinolin-6-yl)hexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102455391 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 4-methyl-N-[(2R)-2-(2-methylquinolin-6-yl)hexyl]benzenesulfonamide |
| SMILES | CCCC[C@@H](CNS(=O)(=O)c1ccc(C)cc1)c1ccc2nc(C)ccc2c1 |
| InChI | InChI=1S/C23H28N2O2S/c1-4-5-6-21(16-24-28(26,27)22-12-7-17(2)8-13-22)19-11-14-23-20(15-19)10-9-18(3)25-23/h7-15,21,24H,4-6,16H2,1-3H3/t21-/m0/s1 |
| InChIKey | WHXHCDPUROWJEA-NRFANRHFSA-N |
| XLogP | 5.10 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |