C21H25NO2 — CID 10245647
(1S,5S,6S)-6-acetyl-1-ethyl-5-phenyl-8-azatricyclo[6.3.1.04,12]dodec-4(12)-en-7-one (PubChem CID 10245647) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (1S,5S,6S)-6-acetyl-1-ethyl-5-phenyl-8-azatricyclo[6.3.1.04,12]dodec-4(12)-en-7-one.
| Compound Name | (1S,5S,6S)-6-acetyl-1-ethyl-5-phenyl-8-azatricyclo[6.3.1.04,12]dodec-4(12)-en-7-one |
|---|---|
| PubChem CID | 10245647 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (1S,5S,6S)-6-acetyl-1-ethyl-5-phenyl-8-azatricyclo[6.3.1.04,12]dodec-4(12)-en-7-one |
| SMILES | CC[C@]12CCCN3C(=O)[C@H](C(C)=O)[C@@H](c4ccccc4)C(=C31)CC2 |
| InChI | InChI=1S/C21H25NO2/c1-3-21-11-7-13-22-19(21)16(10-12-21)18(15-8-5-4-6-9-15)17(14(2)23)20(22)24/h4-6,8-9,17-18H,3,7,10-13H2,1-2H3/t17-,18+,21-/m1/s1 |
| InChIKey | WFKWDEGXYWOZTL-LVCYWYKZSA-N |
| XLogP | 4.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|