C20H16BrNO5 — CID 102456879
methyl (E)-2-bromo-3-[(1-methoxy-1,3-dioxo-3-phenylpropan-2-ylidene)amino]-3-phenylprop-2-enoate (PubChem CID 102456879) has the molecular formula C20H16BrNO5 and a molecular weight of 430.25 g/mol. Its IUPAC name is methyl (E)-2-bromo-3-[(1-methoxy-1,3-dioxo-3-phenylpropan-2-ylidene)amino]-3-phenylprop-2-enoate.
| Compound Name | methyl (E)-2-bromo-3-[(1-methoxy-1,3-dioxo-3-phenylpropan-2-ylidene)amino]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 102456879 |
| Molecular Formula | C20H16BrNO5 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | methyl (E)-2-bromo-3-[(1-methoxy-1,3-dioxo-3-phenylpropan-2-ylidene)amino]-3-phenylprop-2-enoate |
| SMILES | COC(=O)/C(=N\C(=C(\Br)C(=O)OC)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16BrNO5/c1-26-19(24)15(21)16(13-9-5-3-6-10-13)22-17(20(25)27-2)18(23)14-11-7-4-8-12-14/h3-12H,1-2H3/b16-15+,22-17- |
| InChIKey | UMUAENAPMVNOQD-QZCDUAAVSA-N |
| XLogP | 3.42 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|