C20H12O4 — CID 102457084
1,2-bis(prop-2-ynoxy)anthracene-9,10-dione (PubChem CID 102457084) has the molecular formula C20H12O4 and a molecular weight of 316.31 g/mol. Its IUPAC name is 1,2-bis(prop-2-ynoxy)anthracene-9,10-dione.
| Compound Name | 1,2-bis(prop-2-ynoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 102457084 |
| Molecular Formula | C20H12O4 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1,2-bis(prop-2-ynoxy)anthracene-9,10-dione |
| SMILES | C#CCOc1ccc2c(c1OCC#C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H12O4/c1-3-11-23-16-10-9-15-17(20(16)24-12-4-2)19(22)14-8-6-5-7-13(14)18(15)21/h1-2,5-10H,11-12H2 |
| InChIKey | BWWGFLFKFYTOHT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|