C18H12ClNO2 — CID 126123842
(3Z)-3-[(3-chloro-4-prop-2-ynoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 126123842) has the molecular formula C18H12ClNO2 and a molecular weight of 309.75 g/mol. Its IUPAC name is (3Z)-3-[(3-chloro-4-prop-2-ynoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[(3-chloro-4-prop-2-ynoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 126123842 |
| Molecular Formula | C18H12ClNO2 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (3Z)-3-[(3-chloro-4-prop-2-ynoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | C#CCOc1ccc(/C=C2\C(=O)Nc3ccccc32)cc1Cl |
| InChI | InChI=1S/C18H12ClNO2/c1-2-9-22-17-8-7-12(11-15(17)19)10-14-13-5-3-4-6-16(13)20-18(14)21/h1,3-8,10-11H,9H2,(H,20,21)/b14-10- |
| InChIKey | PDGRZOUCBSAHLP-UVTDQMKNSA-N |
| XLogP | 3.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|