C17H10O4 — CID 102457087
1-hydroxy-8-prop-2-ynoxyanthracene-9,10-dione (PubChem CID 102457087) has the molecular formula C17H10O4 and a molecular weight of 278.26 g/mol. Its IUPAC name is 1-hydroxy-8-prop-2-ynoxyanthracene-9,10-dione.
| Compound Name | 1-hydroxy-8-prop-2-ynoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 102457087 |
| Molecular Formula | C17H10O4 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-hydroxy-8-prop-2-ynoxyanthracene-9,10-dione |
| SMILES | C#CCOc1cccc2c1C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C17H10O4/c1-2-9-21-13-8-4-6-11-15(13)17(20)14-10(16(11)19)5-3-7-12(14)18/h1,3-8,18H,9H2 |
| InChIKey | WLRZUIIXHFVZHU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|