C16H16INO3 — CID 102457343
N-[2-[4-(4-hydroxyphenoxy)-3-iodophenyl]ethyl]acetamide (PubChem CID 102457343) has the molecular formula C16H16INO3 and a molecular weight of 397.21 g/mol. Its IUPAC name is N-[2-[4-(4-hydroxyphenoxy)-3-iodophenyl]ethyl]acetamide.
| Compound Name | N-[2-[4-(4-hydroxyphenoxy)-3-iodophenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 102457343 |
| Molecular Formula | C16H16INO3 |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | N-[2-[4-(4-hydroxyphenoxy)-3-iodophenyl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1ccc(Oc2ccc(O)cc2)c(I)c1 |
| InChI | InChI=1S/C16H16INO3/c1-11(19)18-9-8-12-2-7-16(15(17)10-12)21-14-5-3-13(20)4-6-14/h2-7,10,20H,8-9H2,1H3,(H,18,19) |
| InChIKey | RXVVKZYTVSAWAJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|