C27H40O8 — CID 102457426
[(2S,4R,8R,9S,10R)-10-[(1R,3aS,7aR)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-acetyloxy-8-hydroxy-5,5-dimethyl-7-oxo-3,6-dioxatricyclo[6.3.0.04,11]undecan-9-yl] acetate (PubChem CID 102457426) has the molecular formula C27H40O8 and a molecular weight of 492.61 g/mol. Its IUPAC name is [(2S,4R,8R,9S,10R)-10-[(1R,3aS,7aR)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-acetyloxy-8-hydroxy-5,5-dimethyl-7-oxo-3,6-dioxatricyclo[6.3.0.04,11]undecan-9-yl] acetate.
| Compound Name | [(2S,4R,8R,9S,10R)-10-[(1R,3aS,7aR)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-acetyloxy-8-hydroxy-5,5-dimethyl-7-oxo-3,6-dioxatricyclo[6.3.0.04,11]undecan-9-yl] acetate |
|---|---|
| PubChem CID | 102457426 |
| Molecular Formula | C27H40O8 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | [(2S,4R,8R,9S,10R)-10-[(1R,3aS,7aR)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-acetyloxy-8-hydroxy-5,5-dimethyl-7-oxo-3,6-dioxatricyclo[6.3.0.04,11]undecan-9-yl] acetate |
| SMILES | CC(=O)OC1O[C@@H]2C3C([C@H]4CC[C@H]5C(C)(C)CCC[C@]45C)[C@H](OC(C)=O)[C@@](O)(C(=O)OC2(C)C)C13 |
| InChI | InChI=1S/C27H40O8/c1-13(28)32-21-17(15-9-10-16-24(3,4)11-8-12-26(15,16)7)18-19-22(33-14(2)29)34-20(18)25(5,6)35-23(30)27(19,21)31/h15-22,31H,8-12H2,1-7H3/t15-,16+,17?,18?,19?,20-,21+,22?,26-,27-/m1/s1 |
| InChIKey | RRUJHQRWHLMBBI-JMUAQKCESA-N |
| XLogP | 3.38 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|