C27H23NO — CID 102457545
(3R)-3-(5-methyl-2-pyridin-2-ylphenyl)-1,3-diphenylpropan-1-one (PubChem CID 102457545) has the molecular formula C27H23NO and a molecular weight of 377.49 g/mol. Its IUPAC name is (3R)-3-(5-methyl-2-pyridin-2-ylphenyl)-1,3-diphenylpropan-1-one.
| Compound Name | (3R)-3-(5-methyl-2-pyridin-2-ylphenyl)-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 102457545 |
| Molecular Formula | C27H23NO |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (3R)-3-(5-methyl-2-pyridin-2-ylphenyl)-1,3-diphenylpropan-1-one |
| SMILES | Cc1ccc(-c2ccccn2)c([C@H](CC(=O)c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H23NO/c1-20-15-16-23(26-14-8-9-17-28-26)25(18-20)24(21-10-4-2-5-11-21)19-27(29)22-12-6-3-7-13-22/h2-18,24H,19H2,1H3/t24-/m1/s1 |
| InChIKey | SWMTYXQGJAYRLY-XMMPIXPASA-N |
| XLogP | 6.46 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |