C24H32O8 — CID 102458577
[5-acetyloxy-4-[(1R,4R,6R)-1-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-oxo-3,7-dioxabicyclo[4.1.0]heptan-4-yl]-2,5-dihydrofuran-2-yl] acetate (PubChem CID 102458577) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is [5-acetyloxy-4-[(1R,4R,6R)-1-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-oxo-3,7-dioxabicyclo[4.1.0]heptan-4-yl]-2,5-dihydrofuran-2-yl] acetate.
| Compound Name | [5-acetyloxy-4-[(1R,4R,6R)-1-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-oxo-3,7-dioxabicyclo[4.1.0]heptan-4-yl]-2,5-dihydrofuran-2-yl] acetate |
|---|---|
| PubChem CID | 102458577 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [5-acetyloxy-4-[(1R,4R,6R)-1-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-oxo-3,7-dioxabicyclo[4.1.0]heptan-4-yl]-2,5-dihydrofuran-2-yl] acetate |
| SMILES | CC(=O)OC1C=C([C@H]2C[C@H]3O[C@@]3(CC/C=C(\C)CCC=C(C)C)C(=O)O2)C(OC(C)=O)O1 |
| InChI | InChI=1S/C24H32O8/c1-14(2)8-6-9-15(3)10-7-11-24-20(32-24)13-19(30-23(24)27)18-12-21(28-16(4)25)31-22(18)29-17(5)26/h8,10,12,19-22H,6-7,9,11,13H2,1-5H3/b15-10+/t19-,20-,21?,22?,24-/m1/s1 |
| InChIKey | DUKXRTJPMWBLDY-COJFTYMBSA-N |
| XLogP | 3.65 |
| TPSA | 100.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|