C17H23NS2 — CID 102461785
5,6-bis(tert-butylsulfanyl)quinoline (PubChem CID 102461785) has the molecular formula C17H23NS2 and a molecular weight of 305.51 g/mol. Its IUPAC name is 5,6-bis(tert-butylsulfanyl)quinoline.
| Compound Name | 5,6-bis(tert-butylsulfanyl)quinoline |
|---|---|
| PubChem CID | 102461785 |
| Molecular Formula | C17H23NS2 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 5,6-bis(tert-butylsulfanyl)quinoline |
| SMILES | CC(C)(C)Sc1ccc2ncccc2c1SC(C)(C)C |
| InChI | InChI=1S/C17H23NS2/c1-16(2,3)19-14-10-9-13-12(8-7-11-18-13)15(14)20-17(4,5)6/h7-11H,1-6H3 |
| InChIKey | FRRISXISZOJZEY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |