C13H15NS2 — CID 10848255
5,6-bis(ethylsulfanyl)quinoline (PubChem CID 10848255) has the molecular formula C13H15NS2 and a molecular weight of 249.40 g/mol. Its IUPAC name is 5,6-bis(ethylsulfanyl)quinoline.
| Compound Name | 5,6-bis(ethylsulfanyl)quinoline |
|---|---|
| PubChem CID | 10848255 |
| Molecular Formula | C13H15NS2 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 5,6-bis(ethylsulfanyl)quinoline |
| SMILES | CCSc1ccc2ncccc2c1SCC |
| InChI | InChI=1S/C13H15NS2/c1-3-15-12-8-7-11-10(6-5-9-14-11)13(12)16-4-2/h5-9H,3-4H2,1-2H3 |
| InChIKey | ACYYSNBYQNJHIO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |