C9H17NO2 — CID 102464087
(1R,8S,8aS)-1-(hydroxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol (PubChem CID 102464087) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (1R,8S,8aS)-1-(hydroxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol.
| Compound Name | (1R,8S,8aS)-1-(hydroxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol |
|---|---|
| PubChem CID | 102464087 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (1R,8S,8aS)-1-(hydroxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol |
| SMILES | OC[C@@H]1CCN2CCC[C@H](O)[C@H]12 |
| InChI | InChI=1S/C9H17NO2/c11-6-7-3-5-10-4-1-2-8(12)9(7)10/h7-9,11-12H,1-6H2/t7-,8-,9-/m0/s1 |
| InChIKey | RVMASEUWDOTXML-CIUDSAMLSA-N |
| XLogP | -0.18 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |