C14H20N2O — CID 66808184
(1-phenyl-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanol (PubChem CID 66808184) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is (1-phenyl-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanol.
| Compound Name | (1-phenyl-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanol |
|---|---|
| PubChem CID | 66808184 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (1-phenyl-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanol |
| SMILES | OCC1CCN2CCCN(c3ccccc3)C12 |
| InChI | InChI=1S/C14H20N2O/c17-11-12-7-10-15-8-4-9-16(14(12)15)13-5-2-1-3-6-13/h1-3,5-6,12,14,17H,4,7-11H2 |
| InChIKey | KBMPOLIKEJSLQK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |