C22H28N2O3 — CID 102464280
(4S,5S)-2-benzyl-4-(2-methylpropyl)-5-(phenylmethoxyamino)oxazinan-3-one (PubChem CID 102464280) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is (4S,5S)-2-benzyl-4-(2-methylpropyl)-5-(phenylmethoxyamino)oxazinan-3-one.
| Compound Name | (4S,5S)-2-benzyl-4-(2-methylpropyl)-5-(phenylmethoxyamino)oxazinan-3-one |
|---|---|
| PubChem CID | 102464280 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (4S,5S)-2-benzyl-4-(2-methylpropyl)-5-(phenylmethoxyamino)oxazinan-3-one |
| SMILES | CC(C)C[C@@H]1C(=O)N(Cc2ccccc2)OC[C@H]1NOCc1ccccc1 |
| InChI | InChI=1S/C22H28N2O3/c1-17(2)13-20-21(23-26-15-19-11-7-4-8-12-19)16-27-24(22(20)25)14-18-9-5-3-6-10-18/h3-12,17,20-21,23H,13-16H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | JCLODIWFKHDFRP-LEWJYISDSA-N |
| XLogP | 3.71 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|